C4H5N3OS2 — CID 71312787
2,2,2-trideuterio-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)acetamide (PubChem CID 71312787) has the molecular formula C4H5N3OS2 and a molecular weight of 178.26 g/mol. Its IUPAC name is 2,2,2-trideuterio-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)acetamide.
| Compound Name | 2,2,2-trideuterio-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 71312787 |
| Molecular Formula | C4H5N3OS2 |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.01 |
| IUPAC Name | 2,2,2-trideuterio-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)acetamide |
| SMILES | [2H]C([2H])([2H])C(=O)Nc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C4H5N3OS2/c1-2(8)5-3-6-7-4(9)10-3/h1H3,(H,7,9)(H,5,6,8)/i1D3 |
| InChIKey | DWSMAMSVZRCQMP-FIBGUPNXSA-N |
| XLogP | 1.16 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|