About 1-propan-2-ylpyrazolo[3,4-b]pyridin-5-amine
1-propan-2-ylpyrazolo[3,4-b]pyridin-5-amine (PubChem CID 7131393) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-propan-2-ylpyrazolo[3,4-b]pyridin-5-amine.
Molecular Properties
| Compound Name | 1-propan-2-ylpyrazolo[3,4-b]pyridin-5-amine |
| PubChem CID | 7131393 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 1-propan-2-ylpyrazolo[3,4-b]pyridin-5-amine |
| SMILES | CC(C)n1ncc2cc(N)cnc21 |
| InChI | InChI=1S/C9H12N4/c1-6(2)13-9-7(4-12-13)3-8(10)5-11-9/h3-6H,10H2,1-2H3 |
| InChIKey | PMEOZFOGPJEHHE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-propan-2-ylpyrazolo[3,4-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-ylpyrazolo[3,4-b]pyridin-5-amine?
The IUPAC name of 1-propan-2-ylpyrazolo[3,4-b]pyridin-5-amine (CID 7131393) is 1-propan-2-ylpyrazolo[3,4-b]pyridin-5-amine.
What is the SMILES notation for 1-propan-2-ylpyrazolo[3,4-b]pyridin-5-amine?
The canonical SMILES for 1-propan-2-ylpyrazolo[3,4-b]pyridin-5-amine is CC(C)n1ncc2cc(N)cnc21.
What is the InChIKey of 1-propan-2-ylpyrazolo[3,4-b]pyridin-5-amine?
The InChIKey is PMEOZFOGPJEHHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c1-6(2)13-9-7(4-12-13)3-8(10)5-11-9/h3-6H,10H2,1-2H3.
What are the key properties of 1-propan-2-ylpyrazolo[3,4-b]pyridin-5-amine?
1-propan-2-ylpyrazolo[3,4-b]pyridin-5-amine has a molecular weight of 176.22 g/mol, XLogP of 1.59, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-ylpyrazolo[3,4-b]pyridin-5-amine is sourced from PubChem (CID 7131393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).