About 2-[5-fluoro-2,6-dioxo-3-[(2S)-oxolan-2-yl]pyrimidin-1-yl]acetate
2-[5-fluoro-2,6-dioxo-3-[(2S)-oxolan-2-yl]pyrimidin-1-yl]acetate (PubChem CID 7131417) has the molecular formula C10H10FN2O5-
and a molecular weight of 257.20 g/mol. Its IUPAC name is 2-[5-fluoro-2,6-dioxo-3-[(2S)-oxolan-2-yl]pyrimidin-1-yl]acetate.
Molecular Properties
| Compound Name | 2-[5-fluoro-2,6-dioxo-3-[(2S)-oxolan-2-yl]pyrimidin-1-yl]acetate |
| PubChem CID | 7131417 |
| Molecular Formula | C10H10FN2O5- |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 2-[5-fluoro-2,6-dioxo-3-[(2S)-oxolan-2-yl]pyrimidin-1-yl]acetate |
| SMILES | O=C([O-])Cn1c(=O)c(F)cn([C@@H]2CCCO2)c1=O |
| InChI | InChI=1S/C10H11FN2O5/c11-6-4-12(7-2-1-3-18-7)10(17)13(9(6)16)5-8(14)15/h4,7H,1-3,5H2,(H,14,15)/p-1/t7-/m0/s1 |
| InChIKey | XPFDWZAZTFWOQS-ZETCQYMHSA-M |
| XLogP | -1.79 |
| TPSA | 93.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[5-fluoro-2,6-dioxo-3-[(2S)-oxolan-2-yl]pyrimidin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-fluoro-2,6-dioxo-3-[(2S)-oxolan-2-yl]pyrimidin-1-yl]acetate?
The IUPAC name of 2-[5-fluoro-2,6-dioxo-3-[(2S)-oxolan-2-yl]pyrimidin-1-yl]acetate (CID 7131417) is 2-[5-fluoro-2,6-dioxo-3-[(2S)-oxolan-2-yl]pyrimidin-1-yl]acetate.
What is the SMILES notation for 2-[5-fluoro-2,6-dioxo-3-[(2S)-oxolan-2-yl]pyrimidin-1-yl]acetate?
The canonical SMILES for 2-[5-fluoro-2,6-dioxo-3-[(2S)-oxolan-2-yl]pyrimidin-1-yl]acetate is O=C([O-])Cn1c(=O)c(F)cn([C@@H]2CCCO2)c1=O.
What is the InChIKey of 2-[5-fluoro-2,6-dioxo-3-[(2S)-oxolan-2-yl]pyrimidin-1-yl]acetate?
The InChIKey is XPFDWZAZTFWOQS-ZETCQYMHSA-M. The full InChI is InChI=1S/C10H11FN2O5/c11-6-4-12(7-2-1-3-18-7)10(17)13(9(6)16)5-8(14)15/h4,7H,1-3,5H2,(H,14,15)/p-1/t7-/m0/s1.
What are the key properties of 2-[5-fluoro-2,6-dioxo-3-[(2S)-oxolan-2-yl]pyrimidin-1-yl]acetate?
2-[5-fluoro-2,6-dioxo-3-[(2S)-oxolan-2-yl]pyrimidin-1-yl]acetate has a molecular weight of 257.20 g/mol, XLogP of -1.79, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-fluoro-2,6-dioxo-3-[(2S)-oxolan-2-yl]pyrimidin-1-yl]acetate is sourced from PubChem (CID 7131417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).