C3H7BrO2 — CID 71314276
2-bromo-1,1,3,3-tetradeuteriopropane-1,3-diol (PubChem CID 71314276) has the molecular formula C3H7BrO2 and a molecular weight of 159.02 g/mol. Its IUPAC name is 2-bromo-1,1,3,3-tetradeuteriopropane-1,3-diol.
| Compound Name | 2-bromo-1,1,3,3-tetradeuteriopropane-1,3-diol |
|---|---|
| PubChem CID | 71314276 |
| Molecular Formula | C3H7BrO2 |
| Molecular Weight | 159.02 g/mol |
| Exact Mass | 157.99 |
| IUPAC Name | 2-bromo-1,1,3,3-tetradeuteriopropane-1,3-diol |
| SMILES | [2H]C([2H])(O)C(Br)C([2H])([2H])O |
| InChI | InChI=1S/C3H7BrO2/c4-3(1-5)2-6/h3,5-6H,1-2H2/i1D2,2D2 |
| InChIKey | HULFLYYUFHXCLJ-LNLMKGTHSA-N |
| XLogP | -0.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.02 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|