C12H12N2O14S2 — CID 71314312
1-[4-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-4-oxobutanoyl]oxy-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 71314312) has the molecular formula C12H12N2O14S2 and a molecular weight of 472.36 g/mol. Its IUPAC name is 1-[4-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-4-oxobutanoyl]oxy-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | 1-[4-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-4-oxobutanoyl]oxy-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 71314312 |
| Molecular Formula | C12H12N2O14S2 |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 471.97 |
| IUPAC Name | 1-[4-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-4-oxobutanoyl]oxy-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | O=C(CCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C12H12N2O14S2/c15-7-3-5(29(21,22)23)11(19)13(7)27-9(17)1-2-10(18)28-14-8(16)4-6(12(14)20)30(24,25)26/h5-6H,1-4H2,(H,21,22,23)(H,24,25,26) |
| InChIKey | ALXYGYXJUAIRNA-UHFFFAOYSA-N |
| XLogP | -3.29 |
| TPSA | 236.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|