C9H8Cl3NO2S — CID 71314499
4,4,5,6,7,7-hexadeuterio-2-(trichloromethylsulfanyl)-3a,7a-dihydroisoindole-1,3-dione (PubChem CID 71314499) has the molecular formula C9H8Cl3NO2S and a molecular weight of 306.63 g/mol. Its IUPAC name is 4,4,5,6,7,7-hexadeuterio-2-(trichloromethylsulfanyl)-3a,7a-dihydroisoindole-1,3-dione.
| Compound Name | 4,4,5,6,7,7-hexadeuterio-2-(trichloromethylsulfanyl)-3a,7a-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 71314499 |
| Molecular Formula | C9H8Cl3NO2S |
| Molecular Weight | 306.63 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | 4,4,5,6,7,7-hexadeuterio-2-(trichloromethylsulfanyl)-3a,7a-dihydroisoindole-1,3-dione |
| SMILES | [2H]C1=C([2H])C([2H])([2H])C2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C2C1([2H])[2H] |
| InChI | InChI=1S/C9H8Cl3NO2S/c10-9(11,12)16-13-7(14)5-3-1-2-4-6(5)8(13)15/h1-2,5-6H,3-4H2/i1D,2D,3D2,4D2 |
| InChIKey | LDVVMCZRFWMZSG-TZCZJOIZSA-N |
| XLogP | 2.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.63 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|