About 2-benzyl-4-nitrophenol
2-benzyl-4-nitrophenol (PubChem CID 7131473) has the molecular formula C13H11NO3
and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-benzyl-4-nitrophenol.
Molecular Properties
| Compound Name | 2-benzyl-4-nitrophenol |
| PubChem CID | 7131473 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-benzyl-4-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(Cc2ccccc2)c1 |
| InChI | InChI=1S/C13H11NO3/c15-13-7-6-12(14(16)17)9-11(13)8-10-4-2-1-3-5-10/h1-7,9,15H,8H2 |
| InChIKey | LPZJACDNYUKILW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-4-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-4-nitrophenol?
The IUPAC name of 2-benzyl-4-nitrophenol (CID 7131473) is 2-benzyl-4-nitrophenol.
What is the SMILES notation for 2-benzyl-4-nitrophenol?
The canonical SMILES for 2-benzyl-4-nitrophenol is O=[N+]([O-])c1ccc(O)c(Cc2ccccc2)c1.
What is the InChIKey of 2-benzyl-4-nitrophenol?
The InChIKey is LPZJACDNYUKILW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO3/c15-13-7-6-12(14(16)17)9-11(13)8-10-4-2-1-3-5-10/h1-7,9,15H,8H2.
What are the key properties of 2-benzyl-4-nitrophenol?
2-benzyl-4-nitrophenol has a molecular weight of 229.24 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-4-nitrophenol is sourced from PubChem (CID 7131473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).