C12H15BrClNO2 — CID 71315721
2-(4-bromo-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-8-yl)-1,1,2,2-tetradeuterioethanamine;hydrochloride (PubChem CID 71315721) has the molecular formula C12H15BrClNO2 and a molecular weight of 324.64 g/mol. Its IUPAC name is 2-(4-bromo-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-8-yl)-1,1,2,2-tetradeuterioethanamine;hydrochloride.
| Compound Name | 2-(4-bromo-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-8-yl)-1,1,2,2-tetradeuterioethanamine;hydrochloride |
|---|---|
| PubChem CID | 71315721 |
| Molecular Formula | C12H15BrClNO2 |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 2-(4-bromo-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-8-yl)-1,1,2,2-tetradeuterioethanamine;hydrochloride |
| SMILES | Cl.[2H]C([2H])(N)C([2H])([2H])c1c2c(c(Br)c3c1OCC3)OCC2 |
| InChI | InChI=1S/C12H14BrNO2.ClH/c13-10-9-3-6-15-11(9)7(1-4-14)8-2-5-16-12(8)10;/h1-6,14H2;1H/i1D2,4D2; |
| InChIKey | XHRNOQRXDGETTA-MTUADBJDSA-N |
| XLogP | 2.24 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |