C23H31N3O4 — CID 71315746
N-(2,6-dimethylphenyl)-2-[4-[1,1,2,3,3-pentadeuterio-2-hydroxy-3-(2-hydroxyphenoxy)propyl]piperazin-1-yl]acetamide (PubChem CID 71315746) has the molecular formula C23H31N3O4 and a molecular weight of 418.55 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[4-[1,1,2,3,3-pentadeuterio-2-hydroxy-3-(2-hydroxyphenoxy)propyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[4-[1,1,2,3,3-pentadeuterio-2-hydroxy-3-(2-hydroxyphenoxy)propyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 71315746 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[4-[1,1,2,3,3-pentadeuterio-2-hydroxy-3-(2-hydroxyphenoxy)propyl]piperazin-1-yl]acetamide |
| SMILES | [2H]C([2H])(Oc1ccccc1O)C([2H])(O)C([2H])([2H])N1CCN(CC(=O)Nc2c(C)cccc2C)CC1 |
| InChI | InChI=1S/C23H31N3O4/c1-17-6-5-7-18(2)23(17)24-22(29)15-26-12-10-25(11-13-26)14-19(27)16-30-21-9-4-3-8-20(21)28/h3-9,19,27-28H,10-16H2,1-2H3,(H,24,29)/i14D2,16D2,19D |
| InChIKey | JQTKNELUBGGUKI-HLKXKAATSA-N |
| XLogP | 2.01 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |