About 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate
1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate (PubChem CID 7131583) has the molecular formula C6H7N2O3-
and a molecular weight of 155.13 g/mol. Its IUPAC name is 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate.
Molecular Properties
| Compound Name | 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate |
| PubChem CID | 7131583 |
| Molecular Formula | C6H7N2O3- |
| Molecular Weight | 155.13 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate |
| SMILES | CN1N=C(C(=O)[O-])CCC1=O |
| InChI | InChI=1S/C6H8N2O3/c1-8-5(9)3-2-4(7-8)6(10)11/h2-3H2,1H3,(H,10,11)/p-1 |
| InChIKey | QAMPBVPSOZEYTC-UHFFFAOYSA-M |
| XLogP | -1.66 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.13 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate?
The IUPAC name of 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate (CID 7131583) is 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate.
What is the SMILES notation for 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate?
The canonical SMILES for 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate is CN1N=C(C(=O)[O-])CCC1=O.
What is the InChIKey of 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate?
The InChIKey is QAMPBVPSOZEYTC-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8N2O3/c1-8-5(9)3-2-4(7-8)6(10)11/h2-3H2,1H3,(H,10,11)/p-1.
What are the key properties of 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate?
1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate has a molecular weight of 155.13 g/mol, XLogP of -1.66, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate is sourced from PubChem (CID 7131583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).