C37H60FN3O6SSi2 — CID 71315954
prop-2-enyl (E,3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]hept-6-enoate (PubChem CID 71315954) has the molecular formula C37H60FN3O6SSi2 and a molecular weight of 750.14 g/mol. Its IUPAC name is prop-2-enyl (E,3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]hept-6-enoate.
| Compound Name | prop-2-enyl (E,3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]hept-6-enoate |
|---|---|
| PubChem CID | 71315954 |
| Molecular Formula | C37H60FN3O6SSi2 |
| Molecular Weight | 750.14 g/mol |
| Exact Mass | 749.37 |
| IUPAC Name | prop-2-enyl (E,3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]hept-6-enoate |
| SMILES | C=CCOC(=O)C[C@H](C[C@H](/C=C/c1c(-c2ccc(F)cc2)nc(N(C)S(C)(=O)=O)nc1C(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H60FN3O6SSi2/c1-16-23-45-32(42)25-30(47-50(14,15)37(7,8)9)24-29(46-49(12,13)36(4,5)6)21-22-31-33(26(2)3)39-35(41(10)48(11,43)44)40-34(31)27-17-19-28(38)20-18-27/h16-22,26,29-30H,1,23-25H2,2-15H3/b22-21+/t29-,30-/m0/s1 |
| InChIKey | HOCCCCYDOXNZRG-SQJYCXMMSA-N |
| XLogP | 9.11 |
| TPSA | 107.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.14 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|