About 3,4-dihydro-2H-pyrido[1,2-a]pyrimidine;hydrobromide
3,4-dihydro-2H-pyrido[1,2-a]pyrimidine;hydrobromide (PubChem CID 71316203) has the molecular formula C8H11BrN2
and a molecular weight of 215.09 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyrido[1,2-a]pyrimidine;hydrobromide.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-pyrido[1,2-a]pyrimidine;hydrobromide |
| PubChem CID | 71316203 |
| Molecular Formula | C8H11BrN2 |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 3,4-dihydro-2H-pyrido[1,2-a]pyrimidine;hydrobromide |
| SMILES | Br.C1=CC2=NCCCN2C=C1 |
| InChI | InChI=1S/C8H10N2.BrH/c1-2-6-10-7-3-5-9-8(10)4-1;/h1-2,4,6H,3,5,7H2;1H |
| InChIKey | QIJIQJJOUYATTM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dihydro-2H-pyrido[1,2-a]pyrimidine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-pyrido[1,2-a]pyrimidine;hydrobromide?
The IUPAC name of 3,4-dihydro-2H-pyrido[1,2-a]pyrimidine;hydrobromide (CID 71316203) is 3,4-dihydro-2H-pyrido[1,2-a]pyrimidine;hydrobromide.
What is the SMILES notation for 3,4-dihydro-2H-pyrido[1,2-a]pyrimidine;hydrobromide?
The canonical SMILES for 3,4-dihydro-2H-pyrido[1,2-a]pyrimidine;hydrobromide is Br.C1=CC2=NCCCN2C=C1.
What is the InChIKey of 3,4-dihydro-2H-pyrido[1,2-a]pyrimidine;hydrobromide?
The InChIKey is QIJIQJJOUYATTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2.BrH/c1-2-6-10-7-3-5-9-8(10)4-1;/h1-2,4,6H,3,5,7H2;1H.
What are the key properties of 3,4-dihydro-2H-pyrido[1,2-a]pyrimidine;hydrobromide?
3,4-dihydro-2H-pyrido[1,2-a]pyrimidine;hydrobromide has a molecular weight of 215.09 g/mol, XLogP of 1.75, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-pyrido[1,2-a]pyrimidine;hydrobromide is sourced from PubChem (CID 71316203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).