C21H23ClFN3O — CID 71316795
1-[2-[bis(1,1,2,2,2-pentadeuterioethyl)amino]ethyl]-7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one (PubChem CID 71316795) has the molecular formula C21H23ClFN3O and a molecular weight of 397.95 g/mol. Its IUPAC name is 1-[2-[bis(1,1,2,2,2-pentadeuterioethyl)amino]ethyl]-7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one.
| Compound Name | 1-[2-[bis(1,1,2,2,2-pentadeuterioethyl)amino]ethyl]-7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 71316795 |
| Molecular Formula | C21H23ClFN3O |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 1-[2-[bis(1,1,2,2,2-pentadeuterioethyl)amino]ethyl]-7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(CCN1C(=O)CN=C(c2ccccc2F)c2cc(Cl)ccc21)C([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C21H23ClFN3O/c1-3-25(4-2)11-12-26-19-10-9-15(22)13-17(19)21(24-14-20(26)27)16-7-5-6-8-18(16)23/h5-10,13H,3-4,11-12,14H2,1-2H3/i1D3,2D3,3D2,4D2 |
| InChIKey | SAADBVWGJQAEFS-MWUKXHIBSA-N |
| XLogP | 4.00 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |