C13H8Cl6 — CID 71317214
1,2,3,4,7,7-hexachloro-5-phenylbicyclo[2.2.1]hept-2-ene (PubChem CID 71317214) has the molecular formula C13H8Cl6 and a molecular weight of 376.93 g/mol. Its IUPAC name is 1,2,3,4,7,7-hexachloro-5-phenylbicyclo[2.2.1]hept-2-ene.
| Compound Name | 1,2,3,4,7,7-hexachloro-5-phenylbicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 71317214 |
| Molecular Formula | C13H8Cl6 |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 373.88 |
| IUPAC Name | 1,2,3,4,7,7-hexachloro-5-phenylbicyclo[2.2.1]hept-2-ene |
| SMILES | ClC1=C(Cl)C2(Cl)C(c3ccccc3)CC1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C13H8Cl6/c14-9-10(15)12(17)8(7-4-2-1-3-5-7)6-11(9,16)13(12,18)19/h1-5,8H,6H2 |
| InChIKey | MLGHNAMZGTYPPT-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|