C6H12O — CID 71317235
1,2,2,3,3,4,4,5,5,6,6,6-dodecadeuteriohexan-1-one (PubChem CID 71317235) has the molecular formula C6H12O and a molecular weight of 112.23 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6,6-dodecadeuteriohexan-1-one.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6,6-dodecadeuteriohexan-1-one |
|---|---|
| PubChem CID | 71317235 |
| Molecular Formula | C6H12O |
| Molecular Weight | 112.23 g/mol |
| Exact Mass | 112.16 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6,6-dodecadeuteriohexan-1-one |
| SMILES | [2H]C(=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C6H12O/c1-2-3-4-5-6-7/h6H,2-5H2,1H3/i1D3,2D2,3D2,4D2,5D2,6D |
| InChIKey | JARKCYVAAOWBJS-PSDCQUMKSA-N |
| XLogP | 1.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|