About 3-(1-hydroxypropan-2-yloxy)-1,1-dimethoxypropan-2-ol
3-(1-hydroxypropan-2-yloxy)-1,1-dimethoxypropan-2-ol (PubChem CID 71317311) has the molecular formula C8H18O5
and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-(1-hydroxypropan-2-yloxy)-1,1-dimethoxypropan-2-ol.
Molecular Properties
| Compound Name | 3-(1-hydroxypropan-2-yloxy)-1,1-dimethoxypropan-2-ol |
| PubChem CID | 71317311 |
| Molecular Formula | C8H18O5 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 3-(1-hydroxypropan-2-yloxy)-1,1-dimethoxypropan-2-ol |
| SMILES | COC(OC)C(O)COC(C)CO |
| InChI | InChI=1S/C8H18O5/c1-6(4-9)13-5-7(10)8(11-2)12-3/h6-10H,4-5H2,1-3H3 |
| InChIKey | HVXDLHMQVPGGIY-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-hydroxypropan-2-yloxy)-1,1-dimethoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-hydroxypropan-2-yloxy)-1,1-dimethoxypropan-2-ol?
The IUPAC name of 3-(1-hydroxypropan-2-yloxy)-1,1-dimethoxypropan-2-ol (CID 71317311) is 3-(1-hydroxypropan-2-yloxy)-1,1-dimethoxypropan-2-ol.
What is the SMILES notation for 3-(1-hydroxypropan-2-yloxy)-1,1-dimethoxypropan-2-ol?
The canonical SMILES for 3-(1-hydroxypropan-2-yloxy)-1,1-dimethoxypropan-2-ol is COC(OC)C(O)COC(C)CO.
What is the InChIKey of 3-(1-hydroxypropan-2-yloxy)-1,1-dimethoxypropan-2-ol?
The InChIKey is HVXDLHMQVPGGIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O5/c1-6(4-9)13-5-7(10)8(11-2)12-3/h6-10H,4-5H2,1-3H3.
What are the key properties of 3-(1-hydroxypropan-2-yloxy)-1,1-dimethoxypropan-2-ol?
3-(1-hydroxypropan-2-yloxy)-1,1-dimethoxypropan-2-ol has a molecular weight of 194.23 g/mol, XLogP of -0.64, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-hydroxypropan-2-yloxy)-1,1-dimethoxypropan-2-ol is sourced from PubChem (CID 71317311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).