C36H46N4OV — CID 71317325
2,12,13,15,17,18,20,23-octaethyl-23-oxido-21H-porphyrin-23-ium;vanadium (PubChem CID 71317325) has the molecular formula C36H46N4OV and a molecular weight of 601.74 g/mol. Its IUPAC name is 2,12,13,15,17,18,20,23-octaethyl-23-oxido-21H-porphyrin-23-ium;vanadium.
| Compound Name | 2,12,13,15,17,18,20,23-octaethyl-23-oxido-21H-porphyrin-23-ium;vanadium |
|---|---|
| PubChem CID | 71317325 |
| Molecular Formula | C36H46N4OV |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 601.31 |
| IUPAC Name | 2,12,13,15,17,18,20,23-octaethyl-23-oxido-21H-porphyrin-23-ium;vanadium |
| SMILES | CCC1=C(CC)/C2=C(\CC)C3=C(CC)C(CC)=C(/C=C4/C=CC(=N4)/C=c4/cc(CC)/c([nH]4)=C(\CC)C1=N2)[N+]3([O-])CC.[V] |
| InChI | InChI=1S/C36H46N4O.V/c1-9-22-19-25-20-23-17-18-24(37-23)21-32-26(10-2)29(13-5)36(40(32,41)16-8)31(15-7)35-28(12-4)27(11-3)34(39-35)30(14-6)33(22)38-25;/h17-21,38H,9-16H2,1-8H3;/b23-20-,24-21-,25-20-,32-21-,33-30-,34-30-,35-31-,36-31-; |
| InChIKey | ZPSHJLSWBOKBOZ-ZPEOSCHXSA-N |
| XLogP | 7.74 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|