About zinc bis(1-methoxyethanolate)
zinc bis(1-methoxyethanolate) (PubChem CID 71317407) has the molecular formula C6H14O4Zn
and a molecular weight of 215.56 g/mol. Its IUPAC name is zinc bis(1-methoxyethanolate).
Molecular Properties
| Compound Name | zinc bis(1-methoxyethanolate) |
| PubChem CID | 71317407 |
| Molecular Formula | C6H14O4Zn |
| Molecular Weight | 215.56 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | zinc bis(1-methoxyethanolate) |
| SMILES | COC(C)[O-].COC(C)[O-].[Zn+2] |
| InChI | InChI=1S/2C3H7O2.Zn/c2*1-3(4)5-2;/h2*3H,1-2H3;/q2*-1;+2 |
| InChIKey | CGPUDRLVPBEWNF-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 64.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.56 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(1-methoxyethanolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(1-methoxyethanolate)?
The IUPAC name of zinc bis(1-methoxyethanolate) (CID 71317407) is zinc bis(1-methoxyethanolate).
What is the SMILES notation for zinc bis(1-methoxyethanolate)?
The canonical SMILES for zinc bis(1-methoxyethanolate) is COC(C)[O-].COC(C)[O-].[Zn+2].
What is the InChIKey of zinc bis(1-methoxyethanolate)?
The InChIKey is CGPUDRLVPBEWNF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H7O2.Zn/c2*1-3(4)5-2;/h2*3H,1-2H3;/q2*-1;+2.
What are the key properties of zinc bis(1-methoxyethanolate)?
zinc bis(1-methoxyethanolate) has a molecular weight of 215.56 g/mol, XLogP of -1.32, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(1-methoxyethanolate) is sourced from PubChem (CID 71317407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).