About dichloropalladium;bis(4-dicyclohexylphosphanyl-N,N-dimethylaniline)
dichloropalladium;bis(4-dicyclohexylphosphanyl-N,N-dimethylaniline) (PubChem CID 71317458) has the molecular formula C40H64Cl2N2P2Pd
and a molecular weight of 812.24 g/mol. Its IUPAC name is dichloropalladium;bis(4-dicyclohexylphosphanyl-N,N-dimethylaniline).
Molecular Properties
| Compound Name | dichloropalladium;bis(4-dicyclohexylphosphanyl-N,N-dimethylaniline) |
| PubChem CID | 71317458 |
| Molecular Formula | C40H64Cl2N2P2Pd |
| Molecular Weight | 812.24 g/mol |
| Exact Mass | 810.30 |
| IUPAC Name | dichloropalladium;bis(4-dicyclohexylphosphanyl-N,N-dimethylaniline) |
| SMILES | CN(C)c1ccc(P(C2CCCCC2)C2CCCCC2)cc1.CN(C)c1ccc(P(C2CCCCC2)C2CCCCC2)cc1.Cl[Pd]Cl |
| InChI | InChI=1S/2C20H32NP.2ClH.Pd/c2*1-21(2)17-13-15-20(16-14-17)22(18-9-5-3-6-10-18)19-11-7-4-8-12-19;;;/h2*13-16,18-19H,3-12H2,1-2H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | FASFJCMBLNNDNL-UHFFFAOYSA-L |
| XLogP | 12.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 812.24 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloropalladium;bis(4-dicyclohexylphosphanyl-N,N-dimethylaniline) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloropalladium;bis(4-dicyclohexylphosphanyl-N,N-dimethylaniline)?
The IUPAC name of dichloropalladium;bis(4-dicyclohexylphosphanyl-N,N-dimethylaniline) (CID 71317458) is dichloropalladium;bis(4-dicyclohexylphosphanyl-N,N-dimethylaniline).
What is the SMILES notation for dichloropalladium;bis(4-dicyclohexylphosphanyl-N,N-dimethylaniline)?
The canonical SMILES for dichloropalladium;bis(4-dicyclohexylphosphanyl-N,N-dimethylaniline) is CN(C)c1ccc(P(C2CCCCC2)C2CCCCC2)cc1.CN(C)c1ccc(P(C2CCCCC2)C2CCCCC2)cc1.Cl[Pd]Cl.
What is the InChIKey of dichloropalladium;bis(4-dicyclohexylphosphanyl-N,N-dimethylaniline)?
The InChIKey is FASFJCMBLNNDNL-UHFFFAOYSA-L. The full InChI is InChI=1S/2C20H32NP.2ClH.Pd/c2*1-21(2)17-13-15-20(16-14-17)22(18-9-5-3-6-10-18)19-11-7-4-8-12-19;;;/h2*13-16,18-19H,3-12H2,1-2H3;2*1H;/q;;;;+2/p-2.
What are the key properties of dichloropalladium;bis(4-dicyclohexylphosphanyl-N,N-dimethylaniline)?
dichloropalladium;bis(4-dicyclohexylphosphanyl-N,N-dimethylaniline) has a molecular weight of 812.24 g/mol, XLogP of 12.43, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloropalladium;bis(4-dicyclohexylphosphanyl-N,N-dimethylaniline) is sourced from PubChem (CID 71317458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).