About 5-(4-bromophenyl)-2,3-bis(4-methylphenyl)furan
5-(4-bromophenyl)-2,3-bis(4-methylphenyl)furan (PubChem CID 71317707) has the molecular formula C24H19BrO
and a molecular weight of 403.32 g/mol. Its IUPAC name is 5-(4-bromophenyl)-2,3-bis(4-methylphenyl)furan.
Molecular Properties
| Compound Name | 5-(4-bromophenyl)-2,3-bis(4-methylphenyl)furan |
| PubChem CID | 71317707 |
| Molecular Formula | C24H19BrO |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 5-(4-bromophenyl)-2,3-bis(4-methylphenyl)furan |
| SMILES | Cc1ccc(-c2cc(-c3ccc(Br)cc3)oc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H19BrO/c1-16-3-7-18(8-4-16)22-15-23(19-11-13-21(25)14-12-19)26-24(22)20-9-5-17(2)6-10-20/h3-15H,1-2H3 |
| InChIKey | UXNPORCYTBAHMV-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(4-bromophenyl)-2,3-bis(4-methylphenyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromophenyl)-2,3-bis(4-methylphenyl)furan?
The IUPAC name of 5-(4-bromophenyl)-2,3-bis(4-methylphenyl)furan (CID 71317707) is 5-(4-bromophenyl)-2,3-bis(4-methylphenyl)furan.
What is the SMILES notation for 5-(4-bromophenyl)-2,3-bis(4-methylphenyl)furan?
The canonical SMILES for 5-(4-bromophenyl)-2,3-bis(4-methylphenyl)furan is Cc1ccc(-c2cc(-c3ccc(Br)cc3)oc2-c2ccc(C)cc2)cc1.
What is the InChIKey of 5-(4-bromophenyl)-2,3-bis(4-methylphenyl)furan?
The InChIKey is UXNPORCYTBAHMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19BrO/c1-16-3-7-18(8-4-16)22-15-23(19-11-13-21(25)14-12-19)26-24(22)20-9-5-17(2)6-10-20/h3-15H,1-2H3.
What are the key properties of 5-(4-bromophenyl)-2,3-bis(4-methylphenyl)furan?
5-(4-bromophenyl)-2,3-bis(4-methylphenyl)furan has a molecular weight of 403.32 g/mol, XLogP of 7.66, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromophenyl)-2,3-bis(4-methylphenyl)furan is sourced from PubChem (CID 71317707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).