About 3-diazonio-1,8-naphthyridin-4-olate
3-diazonio-1,8-naphthyridin-4-olate (PubChem CID 71317860) has the molecular formula C8H4N4O
and a molecular weight of 172.15 g/mol. Its IUPAC name is 3-diazonio-1,8-naphthyridin-4-olate.
Molecular Properties
| Compound Name | 3-diazonio-1,8-naphthyridin-4-olate |
| PubChem CID | 71317860 |
| Molecular Formula | C8H4N4O |
| Molecular Weight | 172.15 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 3-diazonio-1,8-naphthyridin-4-olate |
| SMILES | N#[N+]c1cnc2ncccc2c1[O-] |
| InChI | InChI=1S/C8H4N4O/c9-12-6-4-11-8-5(7(6)13)2-1-3-10-8/h1-4H |
| InChIKey | NMTAUSYEKIVKEP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 76.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.15 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-diazonio-1,8-naphthyridin-4-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diazonio-1,8-naphthyridin-4-olate?
The IUPAC name of 3-diazonio-1,8-naphthyridin-4-olate (CID 71317860) is 3-diazonio-1,8-naphthyridin-4-olate.
What is the SMILES notation for 3-diazonio-1,8-naphthyridin-4-olate?
The canonical SMILES for 3-diazonio-1,8-naphthyridin-4-olate is N#[N+]c1cnc2ncccc2c1[O-].
What is the InChIKey of 3-diazonio-1,8-naphthyridin-4-olate?
The InChIKey is NMTAUSYEKIVKEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N4O/c9-12-6-4-11-8-5(7(6)13)2-1-3-10-8/h1-4H.
What are the key properties of 3-diazonio-1,8-naphthyridin-4-olate?
3-diazonio-1,8-naphthyridin-4-olate has a molecular weight of 172.15 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diazonio-1,8-naphthyridin-4-olate is sourced from PubChem (CID 71317860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).