C10H10F7NO5 — CID 71317907
4-ethoxy-3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-oxobutanoic acid (PubChem CID 71317907) has the molecular formula C10H10F7NO5 and a molecular weight of 357.18 g/mol. Its IUPAC name is 4-ethoxy-3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-oxobutanoic acid.
| Compound Name | 4-ethoxy-3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71317907 |
| Molecular Formula | C10H10F7NO5 |
| Molecular Weight | 357.18 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 4-ethoxy-3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-oxobutanoic acid |
| SMILES | CCOC(=O)C(CC(=O)O)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F7NO5/c1-2-23-6(21)4(3-5(19)20)18-7(22)8(11,12)9(13,14)10(15,16)17/h4H,2-3H2,1H3,(H,18,22)(H,19,20) |
| InChIKey | GAHLLWWTAWUXEK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|