About 2-amino-3-sulfanylpropanoic acid;1H-pyridine-2-thione
2-amino-3-sulfanylpropanoic acid;1H-pyridine-2-thione (PubChem CID 71317998) has the molecular formula C8H12N2O2S2
and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-amino-3-sulfanylpropanoic acid;1H-pyridine-2-thione.
Molecular Properties
| Compound Name | 2-amino-3-sulfanylpropanoic acid;1H-pyridine-2-thione |
| PubChem CID | 71317998 |
| Molecular Formula | C8H12N2O2S2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 2-amino-3-sulfanylpropanoic acid;1H-pyridine-2-thione |
| SMILES | NC(CS)C(=O)O.S=c1cccc[nH]1 |
| InChI | InChI=1S/C5H5NS.C3H7NO2S/c7-5-3-1-2-4-6-5;4-2(1-7)3(5)6/h1-4H,(H,6,7);2,7H,1,4H2,(H,5,6) |
| InChIKey | DMMGLTMZERKMOB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-sulfanylpropanoic acid;1H-pyridine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-sulfanylpropanoic acid;1H-pyridine-2-thione?
The IUPAC name of 2-amino-3-sulfanylpropanoic acid;1H-pyridine-2-thione (CID 71317998) is 2-amino-3-sulfanylpropanoic acid;1H-pyridine-2-thione.
What is the SMILES notation for 2-amino-3-sulfanylpropanoic acid;1H-pyridine-2-thione?
The canonical SMILES for 2-amino-3-sulfanylpropanoic acid;1H-pyridine-2-thione is NC(CS)C(=O)O.S=c1cccc[nH]1.
What is the InChIKey of 2-amino-3-sulfanylpropanoic acid;1H-pyridine-2-thione?
The InChIKey is DMMGLTMZERKMOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NS.C3H7NO2S/c7-5-3-1-2-4-6-5;4-2(1-7)3(5)6/h1-4H,(H,6,7);2,7H,1,4H2,(H,5,6).
What are the key properties of 2-amino-3-sulfanylpropanoic acid;1H-pyridine-2-thione?
2-amino-3-sulfanylpropanoic acid;1H-pyridine-2-thione has a molecular weight of 232.33 g/mol, XLogP of 1.07, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-sulfanylpropanoic acid;1H-pyridine-2-thione is sourced from PubChem (CID 71317998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).