C30H30N2 — CID 71318023
4-[[4-(dimethylamino)phenyl]-(9H-fluoren-2-yl)methyl]-N,N-dimethylaniline (PubChem CID 71318023) has the molecular formula C30H30N2 and a molecular weight of 418.58 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]-(9H-fluoren-2-yl)methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[4-(dimethylamino)phenyl]-(9H-fluoren-2-yl)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 71318023 |
| Molecular Formula | C30H30N2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]-(9H-fluoren-2-yl)methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(c2ccc(N(C)C)cc2)c2ccc3c(c2)Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C30H30N2/c1-31(2)26-14-9-21(10-15-26)30(22-11-16-27(17-12-22)32(3)4)24-13-18-29-25(20-24)19-23-7-5-6-8-28(23)29/h5-18,20,30H,19H2,1-4H3 |
| InChIKey | OWAYOTTXSVMWTB-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|