C15H26 — CID 71318205
1,5,8,8-tetramethylcycloundeca-1,5-diene (PubChem CID 71318205) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is 1,5,8,8-tetramethylcycloundeca-1,5-diene.
| Compound Name | 1,5,8,8-tetramethylcycloundeca-1,5-diene |
|---|---|
| PubChem CID | 71318205 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 1,5,8,8-tetramethylcycloundeca-1,5-diene |
| SMILES | CC1=CCC(C)(C)CCCC(C)=CCC1 |
| InChI | InChI=1S/C15H26/c1-13-7-5-8-14(2)10-12-15(3,4)11-6-9-13/h7,10H,5-6,8-9,11-12H2,1-4H3 |
| InChIKey | WAAMRUBBXSLLEE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|