About 3,5-dipropoxyaniline
3,5-dipropoxyaniline (PubChem CID 71318426) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is 3,5-dipropoxyaniline.
Molecular Properties
| Compound Name | 3,5-dipropoxyaniline |
| PubChem CID | 71318426 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3,5-dipropoxyaniline |
| SMILES | CCCOc1cc(N)cc(OCCC)c1 |
| InChI | InChI=1S/C12H19NO2/c1-3-5-14-11-7-10(13)8-12(9-11)15-6-4-2/h7-9H,3-6,13H2,1-2H3 |
| InChIKey | LJWDDMWPDKBELS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dipropoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dipropoxyaniline?
The IUPAC name of 3,5-dipropoxyaniline (CID 71318426) is 3,5-dipropoxyaniline.
What is the SMILES notation for 3,5-dipropoxyaniline?
The canonical SMILES for 3,5-dipropoxyaniline is CCCOc1cc(N)cc(OCCC)c1.
What is the InChIKey of 3,5-dipropoxyaniline?
The InChIKey is LJWDDMWPDKBELS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-3-5-14-11-7-10(13)8-12(9-11)15-6-4-2/h7-9H,3-6,13H2,1-2H3.
What are the key properties of 3,5-dipropoxyaniline?
3,5-dipropoxyaniline has a molecular weight of 209.29 g/mol, XLogP of 2.85, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dipropoxyaniline is sourced from PubChem (CID 71318426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).