About 2,4-diaminopyrido[3,2-d]pyrimidine-6-carbaldehyde
2,4-diaminopyrido[3,2-d]pyrimidine-6-carbaldehyde (PubChem CID 71318701) has the molecular formula C8H7N5O
and a molecular weight of 189.18 g/mol. Its IUPAC name is 2,4-diaminopyrido[3,2-d]pyrimidine-6-carbaldehyde.
Molecular Properties
| Compound Name | 2,4-diaminopyrido[3,2-d]pyrimidine-6-carbaldehyde |
| PubChem CID | 71318701 |
| Molecular Formula | C8H7N5O |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 2,4-diaminopyrido[3,2-d]pyrimidine-6-carbaldehyde |
| SMILES | Nc1nc(N)c2nc(C=O)ccc2n1 |
| InChI | InChI=1S/C8H7N5O/c9-7-6-5(12-8(10)13-7)2-1-4(3-14)11-6/h1-3H,(H4,9,10,12,13) |
| InChIKey | VUPAGIQIPGRNOO-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 107.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diaminopyrido[3,2-d]pyrimidine-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diaminopyrido[3,2-d]pyrimidine-6-carbaldehyde?
The IUPAC name of 2,4-diaminopyrido[3,2-d]pyrimidine-6-carbaldehyde (CID 71318701) is 2,4-diaminopyrido[3,2-d]pyrimidine-6-carbaldehyde.
What is the SMILES notation for 2,4-diaminopyrido[3,2-d]pyrimidine-6-carbaldehyde?
The canonical SMILES for 2,4-diaminopyrido[3,2-d]pyrimidine-6-carbaldehyde is Nc1nc(N)c2nc(C=O)ccc2n1.
What is the InChIKey of 2,4-diaminopyrido[3,2-d]pyrimidine-6-carbaldehyde?
The InChIKey is VUPAGIQIPGRNOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5O/c9-7-6-5(12-8(10)13-7)2-1-4(3-14)11-6/h1-3H,(H4,9,10,12,13).
What are the key properties of 2,4-diaminopyrido[3,2-d]pyrimidine-6-carbaldehyde?
2,4-diaminopyrido[3,2-d]pyrimidine-6-carbaldehyde has a molecular weight of 189.18 g/mol, XLogP of 0.00, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diaminopyrido[3,2-d]pyrimidine-6-carbaldehyde is sourced from PubChem (CID 71318701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).