cyclohexylhydrazine;sulfuric acid

C6H16N2O4S — CID 71318733

IUPACcyclohexylhydrazine;sulfuric acid
SMILESNNC1CCCCC1.O=S(=O)(O)O
InChIInChI=1S/C6H14N2.H2O4S/c7-8-6-4-2-1-3-5-6;1-5(2,3)4/h6,8H,1-5,7H2;(H2,1,2,3,4)
InChIKeyHYGTVVBJPFJRKV-UHFFFAOYSA-N
MW212.27 g/mol
LogP0.13
Rot. Bonds1

About cyclohexylhydrazine;sulfuric acid

cyclohexylhydrazine;sulfuric acid (PubChem CID 71318733) has the molecular formula C6H16N2O4S and a molecular weight of 212.27 g/mol. Its IUPAC name is cyclohexylhydrazine;sulfuric acid.

Molecular Properties

Compound Namecyclohexylhydrazine;sulfuric acid
PubChem CID71318733
Molecular FormulaC6H16N2O4S
Molecular Weight212.27 g/mol
Exact Mass212.08
IUPAC Namecyclohexylhydrazine;sulfuric acid
SMILESNNC1CCCCC1.O=S(=O)(O)O
InChIInChI=1S/C6H14N2.H2O4S/c7-8-6-4-2-1-3-5-6;1-5(2,3)4/h6,8H,1-5,7H2;(H2,1,2,3,4)
InChIKeyHYGTVVBJPFJRKV-UHFFFAOYSA-N
XLogP0.13
TPSA112.65 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.27
LogP ≤ 50.13
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze cyclohexylhydrazine;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclohexylhydrazine;sulfuric acid?
The IUPAC name of cyclohexylhydrazine;sulfuric acid (CID 71318733) is cyclohexylhydrazine;sulfuric acid.
What is the SMILES notation for cyclohexylhydrazine;sulfuric acid?
The canonical SMILES for cyclohexylhydrazine;sulfuric acid is NNC1CCCCC1.O=S(=O)(O)O.
What is the InChIKey of cyclohexylhydrazine;sulfuric acid?
The InChIKey is HYGTVVBJPFJRKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.H2O4S/c7-8-6-4-2-1-3-5-6;1-5(2,3)4/h6,8H,1-5,7H2;(H2,1,2,3,4).
What are the key properties of cyclohexylhydrazine;sulfuric acid?
cyclohexylhydrazine;sulfuric acid has a molecular weight of 212.27 g/mol, XLogP of 0.13, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylhydrazine;sulfuric acid is sourced from PubChem (CID 71318733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).