About [5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine
[5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine (PubChem CID 7131884) has the molecular formula C9H10N2OS
and a molecular weight of 194.26 g/mol. Its IUPAC name is [5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine |
| PubChem CID | 7131884 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | [5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine |
| SMILES | Cc1nc(-c2ccc(CN)o2)cs1 |
| InChI | InChI=1S/C9H10N2OS/c1-6-11-8(5-13-6)9-3-2-7(4-10)12-9/h2-3,5H,4,10H2,1H3 |
| InChIKey | KYUQAHJPQLLHQR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine?
The IUPAC name of [5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine (CID 7131884) is [5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine.
What is the SMILES notation for [5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine?
The canonical SMILES for [5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine is Cc1nc(-c2ccc(CN)o2)cs1.
What is the InChIKey of [5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine?
The InChIKey is KYUQAHJPQLLHQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2OS/c1-6-11-8(5-13-6)9-3-2-7(4-10)12-9/h2-3,5H,4,10H2,1H3.
What are the key properties of [5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine?
[5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine has a molecular weight of 194.26 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine is sourced from PubChem (CID 7131884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).