C30H27N3O4 — CID 71318961
1,4,5-triamino-2,6-bis(3,4-dimethylphenoxy)anthracene-9,10-dione (PubChem CID 71318961) has the molecular formula C30H27N3O4 and a molecular weight of 493.56 g/mol. Its IUPAC name is 1,4,5-triamino-2,6-bis(3,4-dimethylphenoxy)anthracene-9,10-dione.
| Compound Name | 1,4,5-triamino-2,6-bis(3,4-dimethylphenoxy)anthracene-9,10-dione |
|---|---|
| PubChem CID | 71318961 |
| Molecular Formula | C30H27N3O4 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 1,4,5-triamino-2,6-bis(3,4-dimethylphenoxy)anthracene-9,10-dione |
| SMILES | Cc1ccc(Oc2ccc3c(c2N)C(=O)c2c(N)cc(Oc4ccc(C)c(C)c4)c(N)c2C3=O)cc1C |
| InChI | InChI=1S/C30H27N3O4/c1-14-5-7-18(11-16(14)3)36-22-10-9-20-24(27(22)32)30(35)25-21(31)13-23(28(33)26(25)29(20)34)37-19-8-6-15(2)17(4)12-19/h5-13H,31-33H2,1-4H3 |
| InChIKey | SUJOLTHBPWSETG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 130.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|