C36H40N4O4 — CID 71318976
1,4,5,8-tetraamino-2,7-bis(3-pentylphenoxy)anthracene-9,10-dione (PubChem CID 71318976) has the molecular formula C36H40N4O4 and a molecular weight of 592.74 g/mol. Its IUPAC name is 1,4,5,8-tetraamino-2,7-bis(3-pentylphenoxy)anthracene-9,10-dione.
| Compound Name | 1,4,5,8-tetraamino-2,7-bis(3-pentylphenoxy)anthracene-9,10-dione |
|---|---|
| PubChem CID | 71318976 |
| Molecular Formula | C36H40N4O4 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | 1,4,5,8-tetraamino-2,7-bis(3-pentylphenoxy)anthracene-9,10-dione |
| SMILES | CCCCCc1cccc(Oc2cc(N)c3c(c2N)C(=O)c2c(N)c(Oc4cccc(CCCCC)c4)cc(N)c2C3=O)c1 |
| InChI | InChI=1S/C36H40N4O4/c1-3-5-7-11-21-13-9-15-23(17-21)43-27-19-25(37)29-31(33(27)39)36(42)32-30(35(29)41)26(38)20-28(34(32)40)44-24-16-10-14-22(18-24)12-8-6-4-2/h9-10,13-20H,3-8,11-12,37-40H2,1-2H3 |
| InChIKey | CJOIXTJTIPPACY-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 156.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|