About 3-hexyl-5-methoxyphenol
3-hexyl-5-methoxyphenol (PubChem CID 71319233) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is 3-hexyl-5-methoxyphenol.
Molecular Properties
| Compound Name | 3-hexyl-5-methoxyphenol |
| PubChem CID | 71319233 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 3-hexyl-5-methoxyphenol |
| SMILES | CCCCCCc1cc(O)cc(OC)c1 |
| InChI | InChI=1S/C13H20O2/c1-3-4-5-6-7-11-8-12(14)10-13(9-11)15-2/h8-10,14H,3-7H2,1-2H3 |
| InChIKey | AQGNMKRJQKGKIK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hexyl-5-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexyl-5-methoxyphenol?
The IUPAC name of 3-hexyl-5-methoxyphenol (CID 71319233) is 3-hexyl-5-methoxyphenol.
What is the SMILES notation for 3-hexyl-5-methoxyphenol?
The canonical SMILES for 3-hexyl-5-methoxyphenol is CCCCCCc1cc(O)cc(OC)c1.
What is the InChIKey of 3-hexyl-5-methoxyphenol?
The InChIKey is AQGNMKRJQKGKIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2/c1-3-4-5-6-7-11-8-12(14)10-13(9-11)15-2/h8-10,14H,3-7H2,1-2H3.
What are the key properties of 3-hexyl-5-methoxyphenol?
3-hexyl-5-methoxyphenol has a molecular weight of 208.30 g/mol, XLogP of 3.52, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexyl-5-methoxyphenol is sourced from PubChem (CID 71319233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).