C11H12N2O3S — CID 71320241
2-nitro-3-(4,5,6,7-tetrahydro-1-benzothiophen-2-ylamino)prop-2-enal (PubChem CID 71320241) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-nitro-3-(4,5,6,7-tetrahydro-1-benzothiophen-2-ylamino)prop-2-enal.
| Compound Name | 2-nitro-3-(4,5,6,7-tetrahydro-1-benzothiophen-2-ylamino)prop-2-enal |
|---|---|
| PubChem CID | 71320241 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2-nitro-3-(4,5,6,7-tetrahydro-1-benzothiophen-2-ylamino)prop-2-enal |
| SMILES | O=CC(=CNc1cc2c(s1)CCCC2)[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N2O3S/c14-7-9(13(15)16)6-12-11-5-8-3-1-2-4-10(8)17-11/h5-7,12H,1-4H2 |
| InChIKey | CNNOUZHFIMHSKA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|