C12H13F9O2 — CID 71320864
methyl 4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexane-1-carboxylate (PubChem CID 71320864) has the molecular formula C12H13F9O2 and a molecular weight of 360.22 g/mol. Its IUPAC name is methyl 4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexane-1-carboxylate.
| Compound Name | methyl 4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 71320864 |
| Molecular Formula | C12H13F9O2 |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | methyl 4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H13F9O2/c1-23-8(22)6-2-4-7(5-3-6)9(13,14)10(15,16)11(17,18)12(19,20)21/h6-7H,2-5H2,1H3 |
| InChIKey | KBFOWDPRJADBCX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|