About 5-chloropent-4-enamide
5-chloropent-4-enamide (PubChem CID 71321205) has the molecular formula C5H8ClNO
and a molecular weight of 133.58 g/mol. Its IUPAC name is 5-chloropent-4-enamide.
Molecular Properties
| Compound Name | 5-chloropent-4-enamide |
| PubChem CID | 71321205 |
| Molecular Formula | C5H8ClNO |
| Molecular Weight | 133.58 g/mol |
| Exact Mass | 133.03 |
| IUPAC Name | 5-chloropent-4-enamide |
| SMILES | NC(=O)CCC=CCl |
| InChI | InChI=1S/C5H8ClNO/c6-4-2-1-3-5(7)8/h2,4H,1,3H2,(H2,7,8) |
| InChIKey | LENXVFDJHQSOPX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.58 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloropent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloropent-4-enamide?
The IUPAC name of 5-chloropent-4-enamide (CID 71321205) is 5-chloropent-4-enamide.
What is the SMILES notation for 5-chloropent-4-enamide?
The canonical SMILES for 5-chloropent-4-enamide is NC(=O)CCC=CCl.
What is the InChIKey of 5-chloropent-4-enamide?
The InChIKey is LENXVFDJHQSOPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClNO/c6-4-2-1-3-5(7)8/h2,4H,1,3H2,(H2,7,8).
What are the key properties of 5-chloropent-4-enamide?
5-chloropent-4-enamide has a molecular weight of 133.58 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloropent-4-enamide is sourced from PubChem (CID 71321205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).