About N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-sulfonamide
N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-sulfonamide (PubChem CID 713213) has the molecular formula C13H20N2O5S
and a molecular weight of 316.38 g/mol. Its IUPAC name is N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-sulfonamide.
Molecular Properties
| Compound Name | N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-sulfonamide |
| PubChem CID | 713213 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-sulfonamide |
| SMILES | COc1cc(NS(=O)(=O)N2CCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C13H20N2O5S/c1-18-11-8-10(9-12(19-2)13(11)20-3)14-21(16,17)15-6-4-5-7-15/h8-9,14H,4-7H2,1-3H3 |
| InChIKey | WPBBSYJLTOLIPH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-sulfonamide?
The IUPAC name of N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-sulfonamide (CID 713213) is N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-sulfonamide.
What is the SMILES notation for N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-sulfonamide?
The canonical SMILES for N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-sulfonamide is COc1cc(NS(=O)(=O)N2CCCC2)cc(OC)c1OC.
What is the InChIKey of N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-sulfonamide?
The InChIKey is WPBBSYJLTOLIPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O5S/c1-18-11-8-10(9-12(19-2)13(11)20-3)14-21(16,17)15-6-4-5-7-15/h8-9,14H,4-7H2,1-3H3.
What are the key properties of N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-sulfonamide?
N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-sulfonamide has a molecular weight of 316.38 g/mol, XLogP of 1.46, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-sulfonamide is sourced from PubChem (CID 713213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).