About 4-butyl-5-hydroxy-2,3-dihydropyran-6-one
4-butyl-5-hydroxy-2,3-dihydropyran-6-one (PubChem CID 71321621) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is 4-butyl-5-hydroxy-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 4-butyl-5-hydroxy-2,3-dihydropyran-6-one |
| PubChem CID | 71321621 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 4-butyl-5-hydroxy-2,3-dihydropyran-6-one |
| SMILES | CCCCC1=C(O)C(=O)OCC1 |
| InChI | InChI=1S/C9H14O3/c1-2-3-4-7-5-6-12-9(11)8(7)10/h10H,2-6H2,1H3 |
| InChIKey | GTRMPHMXNILJED-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-butyl-5-hydroxy-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-5-hydroxy-2,3-dihydropyran-6-one?
The IUPAC name of 4-butyl-5-hydroxy-2,3-dihydropyran-6-one (CID 71321621) is 4-butyl-5-hydroxy-2,3-dihydropyran-6-one.
What is the SMILES notation for 4-butyl-5-hydroxy-2,3-dihydropyran-6-one?
The canonical SMILES for 4-butyl-5-hydroxy-2,3-dihydropyran-6-one is CCCCC1=C(O)C(=O)OCC1.
What is the InChIKey of 4-butyl-5-hydroxy-2,3-dihydropyran-6-one?
The InChIKey is GTRMPHMXNILJED-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-2-3-4-7-5-6-12-9(11)8(7)10/h10H,2-6H2,1H3.
What are the key properties of 4-butyl-5-hydroxy-2,3-dihydropyran-6-one?
4-butyl-5-hydroxy-2,3-dihydropyran-6-one has a molecular weight of 170.21 g/mol, XLogP of 1.94, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-5-hydroxy-2,3-dihydropyran-6-one is sourced from PubChem (CID 71321621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).