C20H17ClN4O4 — CID 71321866
1-[(2,5-diphenyl-1,2,4-triazol-3-yl)methyl]pyridin-1-ium perchlorate (PubChem CID 71321866) has the molecular formula C20H17ClN4O4 and a molecular weight of 412.83 g/mol. Its IUPAC name is 1-[(2,5-diphenyl-1,2,4-triazol-3-yl)methyl]pyridin-1-ium perchlorate.
| Compound Name | 1-[(2,5-diphenyl-1,2,4-triazol-3-yl)methyl]pyridin-1-ium perchlorate |
|---|---|
| PubChem CID | 71321866 |
| Molecular Formula | C20H17ClN4O4 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 1-[(2,5-diphenyl-1,2,4-triazol-3-yl)methyl]pyridin-1-ium perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc(-c2nc(C[n+]3ccccc3)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H17N4.ClHO4/c1-4-10-17(11-5-1)20-21-19(16-23-14-8-3-9-15-23)24(22-20)18-12-6-2-7-13-18;2-1(3,4)5/h1-15H,16H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | BZIOSQXDBXUKFN-UHFFFAOYSA-M |
| XLogP | -1.49 |
| TPSA | 126.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|