C15H25I — CID 71322111
1-iodo-3,7,11-trimethyldodeca-2,6,10-triene (PubChem CID 71322111) has the molecular formula C15H25I and a molecular weight of 332.27 g/mol. Its IUPAC name is 1-iodo-3,7,11-trimethyldodeca-2,6,10-triene.
| Compound Name | 1-iodo-3,7,11-trimethyldodeca-2,6,10-triene |
|---|---|
| PubChem CID | 71322111 |
| Molecular Formula | C15H25I |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1-iodo-3,7,11-trimethyldodeca-2,6,10-triene |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCI |
| InChI | InChI=1S/C15H25I/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11H,5-6,8,10,12H2,1-4H3 |
| InChIKey | SOTNRCBDDRIJAF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|