About 3'-(benzenesulfonyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane]
3'-(benzenesulfonyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane] (PubChem CID 71322746) has the molecular formula C14H16O3S
and a molecular weight of 264.35 g/mol. Its IUPAC name is 3'-(benzenesulfonyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane].
Molecular Properties
| Compound Name | 3'-(benzenesulfonyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane] |
| PubChem CID | 71322746 |
| Molecular Formula | C14H16O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 3'-(benzenesulfonyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane] |
| SMILES | O=S(=O)(c1ccccc1)C1OC12CC1CCC2C1 |
| InChI | InChI=1S/C14H16O3S/c15-18(16,12-4-2-1-3-5-12)13-14(17-13)9-10-6-7-11(14)8-10/h1-5,10-11,13H,6-9H2 |
| InChIKey | CGRCNOGGLVDXLR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3'-(benzenesulfonyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-(benzenesulfonyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane]?
The IUPAC name of 3'-(benzenesulfonyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane] (CID 71322746) is 3'-(benzenesulfonyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane].
What is the SMILES notation for 3'-(benzenesulfonyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane]?
The canonical SMILES for 3'-(benzenesulfonyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane] is O=S(=O)(c1ccccc1)C1OC12CC1CCC2C1.
What is the InChIKey of 3'-(benzenesulfonyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane]?
The InChIKey is CGRCNOGGLVDXLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O3S/c15-18(16,12-4-2-1-3-5-12)13-14(17-13)9-10-6-7-11(14)8-10/h1-5,10-11,13H,6-9H2.
What are the key properties of 3'-(benzenesulfonyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane]?
3'-(benzenesulfonyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane] has a molecular weight of 264.35 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-(benzenesulfonyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane] is sourced from PubChem (CID 71322746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).