About 2-(1,2-dihydronaphthalen-2-yl)-1,2-dihydronaphthalene
2-(1,2-dihydronaphthalen-2-yl)-1,2-dihydronaphthalene (PubChem CID 71322997) has the molecular formula C20H18
and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-(1,2-dihydronaphthalen-2-yl)-1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | 2-(1,2-dihydronaphthalen-2-yl)-1,2-dihydronaphthalene |
| PubChem CID | 71322997 |
| Molecular Formula | C20H18 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-(1,2-dihydronaphthalen-2-yl)-1,2-dihydronaphthalene |
| SMILES | C1=CC(C2C=Cc3ccccc3C2)Cc2ccccc21 |
| InChI | InChI=1S/C20H18/c1-3-7-17-13-19(11-9-15(17)5-1)20-12-10-16-6-2-4-8-18(16)14-20/h1-12,19-20H,13-14H2 |
| InChIKey | BYEFRAKEWDGEJV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(1,2-dihydronaphthalen-2-yl)-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-dihydronaphthalen-2-yl)-1,2-dihydronaphthalene?
The IUPAC name of 2-(1,2-dihydronaphthalen-2-yl)-1,2-dihydronaphthalene (CID 71322997) is 2-(1,2-dihydronaphthalen-2-yl)-1,2-dihydronaphthalene.
What is the SMILES notation for 2-(1,2-dihydronaphthalen-2-yl)-1,2-dihydronaphthalene?
The canonical SMILES for 2-(1,2-dihydronaphthalen-2-yl)-1,2-dihydronaphthalene is C1=CC(C2C=Cc3ccccc3C2)Cc2ccccc21.
What is the InChIKey of 2-(1,2-dihydronaphthalen-2-yl)-1,2-dihydronaphthalene?
The InChIKey is BYEFRAKEWDGEJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18/c1-3-7-17-13-19(11-9-15(17)5-1)20-12-10-16-6-2-4-8-18(16)14-20/h1-12,19-20H,13-14H2.
What are the key properties of 2-(1,2-dihydronaphthalen-2-yl)-1,2-dihydronaphthalene?
2-(1,2-dihydronaphthalen-2-yl)-1,2-dihydronaphthalene has a molecular weight of 258.36 g/mol, XLogP of 4.76, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dihydronaphthalen-2-yl)-1,2-dihydronaphthalene is sourced from PubChem (CID 71322997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).