C14H10N4 — CID 71323044
5-amino-2-methyl-6-phenylpyridine-3,4-dicarbonitrile (PubChem CID 71323044) has the molecular formula C14H10N4 and a molecular weight of 234.26 g/mol. Its IUPAC name is 5-amino-2-methyl-6-phenylpyridine-3,4-dicarbonitrile.
| Compound Name | 5-amino-2-methyl-6-phenylpyridine-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 71323044 |
| Molecular Formula | C14H10N4 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 5-amino-2-methyl-6-phenylpyridine-3,4-dicarbonitrile |
| SMILES | Cc1nc(-c2ccccc2)c(N)c(C#N)c1C#N |
| InChI | InChI=1S/C14H10N4/c1-9-11(7-15)12(8-16)13(17)14(18-9)10-5-3-2-4-6-10/h2-6H,17H2,1H3 |
| InChIKey | AAGHCZBKOCXRFK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |