C12H16O4 — CID 71323072
2,5-dimethyl-3,6-bis(prop-2-ynoxy)-1,4-dioxane (PubChem CID 71323072) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2,5-dimethyl-3,6-bis(prop-2-ynoxy)-1,4-dioxane.
| Compound Name | 2,5-dimethyl-3,6-bis(prop-2-ynoxy)-1,4-dioxane |
|---|---|
| PubChem CID | 71323072 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2,5-dimethyl-3,6-bis(prop-2-ynoxy)-1,4-dioxane |
| SMILES | C#CCOC1OC(C)C(OCC#C)OC1C |
| InChI | InChI=1S/C12H16O4/c1-5-7-13-11-9(3)16-12(10(4)15-11)14-8-6-2/h1-2,9-12H,7-8H2,3-4H3 |
| InChIKey | FTUYYORKLGZHBN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|