C8H2Cl2N2O6 — CID 71323152
2,3-dinitrobenzene-1,4-dicarbonyl chloride (PubChem CID 71323152) has the molecular formula C8H2Cl2N2O6 and a molecular weight of 293.02 g/mol. Its IUPAC name is 2,3-dinitrobenzene-1,4-dicarbonyl chloride.
| Compound Name | 2,3-dinitrobenzene-1,4-dicarbonyl chloride |
|---|---|
| PubChem CID | 71323152 |
| Molecular Formula | C8H2Cl2N2O6 |
| Molecular Weight | 293.02 g/mol |
| Exact Mass | 291.93 |
| IUPAC Name | 2,3-dinitrobenzene-1,4-dicarbonyl chloride |
| SMILES | O=C(Cl)c1ccc(C(=O)Cl)c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H2Cl2N2O6/c9-7(13)3-1-2-4(8(10)14)6(12(17)18)5(3)11(15)16/h1-2H |
| InChIKey | FXJCZDRWXDMMMB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.02 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|