C10H12N2O2 — CID 71323651
N-[2-(N-hydroxy-C-methylcarbonimidoyl)phenyl]acetamide (PubChem CID 71323651) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is N-[2-(N-hydroxy-C-methylcarbonimidoyl)phenyl]acetamide.
| Compound Name | N-[2-(N-hydroxy-C-methylcarbonimidoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 71323651 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | N-[2-(N-hydroxy-C-methylcarbonimidoyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1C(C)=NO |
| InChI | InChI=1S/C10H12N2O2/c1-7(12-14)9-5-3-4-6-10(9)11-8(2)13/h3-6,14H,1-2H3,(H,11,13) |
| InChIKey | UOGFJUFIWQTMCM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|