About [1-(4-methylphenyl)-6,7-dihydro-5H-quinolin-8-yl]-phenylmethanone
[1-(4-methylphenyl)-6,7-dihydro-5H-quinolin-8-yl]-phenylmethanone (PubChem CID 71324029) has the molecular formula C23H21NO
and a molecular weight of 327.43 g/mol. Its IUPAC name is [1-(4-methylphenyl)-6,7-dihydro-5H-quinolin-8-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [1-(4-methylphenyl)-6,7-dihydro-5H-quinolin-8-yl]-phenylmethanone |
| PubChem CID | 71324029 |
| Molecular Formula | C23H21NO |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | [1-(4-methylphenyl)-6,7-dihydro-5H-quinolin-8-yl]-phenylmethanone |
| SMILES | Cc1ccc(N2C=CC=C3CCCC(C(=O)c4ccccc4)=C32)cc1 |
| InChI | InChI=1S/C23H21NO/c1-17-12-14-20(15-13-17)24-16-6-10-18-9-5-11-21(22(18)24)23(25)19-7-3-2-4-8-19/h2-4,6-8,10,12-16H,5,9,11H2,1H3 |
| InChIKey | TUIHBEMUIKIXCG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(4-methylphenyl)-6,7-dihydro-5H-quinolin-8-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-methylphenyl)-6,7-dihydro-5H-quinolin-8-yl]-phenylmethanone?
The IUPAC name of [1-(4-methylphenyl)-6,7-dihydro-5H-quinolin-8-yl]-phenylmethanone (CID 71324029) is [1-(4-methylphenyl)-6,7-dihydro-5H-quinolin-8-yl]-phenylmethanone.
What is the SMILES notation for [1-(4-methylphenyl)-6,7-dihydro-5H-quinolin-8-yl]-phenylmethanone?
The canonical SMILES for [1-(4-methylphenyl)-6,7-dihydro-5H-quinolin-8-yl]-phenylmethanone is Cc1ccc(N2C=CC=C3CCCC(C(=O)c4ccccc4)=C32)cc1.
What is the InChIKey of [1-(4-methylphenyl)-6,7-dihydro-5H-quinolin-8-yl]-phenylmethanone?
The InChIKey is TUIHBEMUIKIXCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO/c1-17-12-14-20(15-13-17)24-16-6-10-18-9-5-11-21(22(18)24)23(25)19-7-3-2-4-8-19/h2-4,6-8,10,12-16H,5,9,11H2,1H3.
What are the key properties of [1-(4-methylphenyl)-6,7-dihydro-5H-quinolin-8-yl]-phenylmethanone?
[1-(4-methylphenyl)-6,7-dihydro-5H-quinolin-8-yl]-phenylmethanone has a molecular weight of 327.43 g/mol, XLogP of 5.58, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-methylphenyl)-6,7-dihydro-5H-quinolin-8-yl]-phenylmethanone is sourced from PubChem (CID 71324029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).