C13H20FNO2 — CID 71324122
N,N-diethylethanamine;4-fluorobenzoic acid (PubChem CID 71324122) has the molecular formula C13H20FNO2 and a molecular weight of 241.31 g/mol. Its IUPAC name is N,N-diethylethanamine;4-fluorobenzoic acid.
| Compound Name | N,N-diethylethanamine;4-fluorobenzoic acid |
|---|---|
| PubChem CID | 71324122 |
| Molecular Formula | C13H20FNO2 |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | N,N-diethylethanamine;4-fluorobenzoic acid |
| SMILES | CCN(CC)CC.O=C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C7H5FO2.C6H15N/c8-6-3-1-5(2-4-6)7(9)10;1-4-7(5-2)6-3/h1-4H,(H,9,10);4-6H2,1-3H3 |
| InChIKey | BIADOOIPWVSTDC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |