C19H29ClN3O2+ — CID 7132416
[3-[(3S)-4-(4-chlorobenzoyl)-3-methylpiperazin-1-yl]-3-oxopropyl]-(2-methylpropyl)azanium (PubChem CID 7132416) has the molecular formula C19H29ClN3O2+ and a molecular weight of 366.91 g/mol. Its IUPAC name is [3-[(3S)-4-(4-chlorobenzoyl)-3-methylpiperazin-1-yl]-3-oxopropyl]-(2-methylpropyl)azanium.
| Compound Name | [3-[(3S)-4-(4-chlorobenzoyl)-3-methylpiperazin-1-yl]-3-oxopropyl]-(2-methylpropyl)azanium |
|---|---|
| PubChem CID | 7132416 |
| Molecular Formula | C19H29ClN3O2+ |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | [3-[(3S)-4-(4-chlorobenzoyl)-3-methylpiperazin-1-yl]-3-oxopropyl]-(2-methylpropyl)azanium |
| SMILES | CC(C)C[NH2+]CCC(=O)N1CCN(C(=O)c2ccc(Cl)cc2)[C@@H](C)C1 |
| InChI | InChI=1S/C19H28ClN3O2/c1-14(2)12-21-9-8-18(24)22-10-11-23(15(3)13-22)19(25)16-4-6-17(20)7-5-16/h4-7,14-15,21H,8-13H2,1-3H3/p+1/t15-/m0/s1 |
| InChIKey | YBRZBFHTJAGLOZ-HNNXBMFYSA-O |
| XLogP | 1.62 |
| TPSA | 57.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|