C4HCl5OS — CID 71324461
1,1,2,3,4-pentachloro-4-hydroxysulfanylbuta-1,3-diene (PubChem CID 71324461) has the molecular formula C4HCl5OS and a molecular weight of 274.38 g/mol. Its IUPAC name is 1,1,2,3,4-pentachloro-4-hydroxysulfanylbuta-1,3-diene.
| Compound Name | 1,1,2,3,4-pentachloro-4-hydroxysulfanylbuta-1,3-diene |
|---|---|
| PubChem CID | 71324461 |
| Molecular Formula | C4HCl5OS |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 271.82 |
| IUPAC Name | 1,1,2,3,4-pentachloro-4-hydroxysulfanylbuta-1,3-diene |
| SMILES | OSC(Cl)=C(Cl)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C4HCl5OS/c5-1(3(7)8)2(6)4(9)11-10/h10H |
| InChIKey | OPBYXKWUGGEENE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|