C8H20SSi2 — CID 71325105
2-ethyl-2,6,6-trimethyl-1,2,6-thiadisilinane (PubChem CID 71325105) has the molecular formula C8H20SSi2 and a molecular weight of 204.49 g/mol. Its IUPAC name is 2-ethyl-2,6,6-trimethyl-1,2,6-thiadisilinane.
| Compound Name | 2-ethyl-2,6,6-trimethyl-1,2,6-thiadisilinane |
|---|---|
| PubChem CID | 71325105 |
| Molecular Formula | C8H20SSi2 |
| Molecular Weight | 204.49 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 2-ethyl-2,6,6-trimethyl-1,2,6-thiadisilinane |
| SMILES | CC[Si]1(C)CCC[Si](C)(C)S1 |
| InChI | InChI=1S/C8H20SSi2/c1-5-11(4)8-6-7-10(2,3)9-11/h5-8H2,1-4H3 |
| InChIKey | YODHBYLGDRTWMB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|